Abstract
The values of the fraction of ionizes phenyl salicylate, fPS-, obtained from initial absorbance measurement of phenyl salicylate at 350 nm, remain unchanged with the increase in [CH3CO2Na] from 0.0 to 0.7 M at 0.01 M NaOH (fPS- ≈ 0.70) and 0.02 M NaOH (fPS- ≈ 0.93). The values of fPS- decrease from ∼ 1.0 to 0.90 and ∼ 1.0 to 0.84 with the increase in respective [CH3CO2Na] and [NaBr] from 0.0 to 0.6 M at 0.01 M NaOH, 0.02 M C12E23(=C12H25(OCH2CH2)23OH) and 0.01 M CTABr (=C16H33NMe3Br).
The authors thank Universiti Malaya for financial support (Grant No. F0718=2002B) for carrying out this work.
Notes
a [Phenyl salicylate]0 = 2.0 × 10−4 M, 35°C, 98% (v/v) H2O and 2% (v/v) CH3CN.
b The required amounts of [C6H5COONa] were generated into the reaction mixtures by using the stock solutions (w M) of benzoic acid in (w + 0.05) M aqueous NaOH. The stock solution (0.5 M) of NaOH was used to produce a fixed known concentration of NaOH into the reaction mixture for each kinetic run.
c fPS- = /A0 where A0 = 1.40.
a [Phenyl salicylate]0 = 2.0 × 10−4 M, 35°C, 98% (v/v) H2O and 2% (v/v) CH3CN.
b [NaOH] = 0.01 M.
c The required amounts of [C6H5COONa] were generated into the reaction mixtures by using the stock solutions (w M) of benzoic acid in (w + 0.05) M aqueous NaOH. The stock solution (0.5 M) of NaOH was used to produce a fixed known concentration of NaOH into the reaction mixture for each kinetic run.
d fPS- = /A0 where A0 = 1.40 and parenthesized values were calculated with A0 = 1.47.